3,2'-Dihydroxy-5'-methoxy-4,5-methylene-dioxybibenzyl
| Internal ID | 7915c39e-61c4-464b-bc4a-9d2d9e16d5e5 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 6-[2-(2-hydroxy-5-methoxyphenyl)ethyl]-1,3-benzodioxol-4-ol |
| SMILES (Canonical) | COC1=CC(=C(C=C1)O)CCC2=CC(=C3C(=C2)OCO3)O |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)O)CCC2=CC(=C3C(=C2)OCO3)O |
| InChI | InChI=1S/C16H16O5/c1-19-12-4-5-13(17)11(8-12)3-2-10-6-14(18)16-15(7-10)20-9-21-16/h4-8,17-18H,2-3,9H2,1H3 |
| InChI Key | HGKUEBJEQDAVDX-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.97% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.72% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.26% | 90.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.87% | 92.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.23% | 94.45% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.96% | 96.77% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.48% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.20% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.17% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.35% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.43% | 93.99% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.51% | 94.73% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.43% | 93.40% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.42% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.78% | 95.89% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 84.44% | 83.57% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.05% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.34% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bulbophyllum andersonii |
| PubChem | 15081430 |
| LOTUS | LTS0150024 |
| wikiData | Q105027825 |