(1S,3R,4R,5R)-1,3,4-trihydroxy-5-[3-(5-methoxy-1-benzofuran-6-yl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid
| Internal ID | f8938c8f-1e83-4d31-94b6-ff9ff9871cc3 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Cyclitols and derivatives > Quinic acids and derivatives |
| IUPAC Name | (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[3-(5-methoxy-1-benzofuran-6-yl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid |
| SMILES (Canonical) | COC1=C(C=C2C(=C1)C=CO2)C=CC(=O)OC3CC(CC(C3O)O)(C(=O)O)O |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1)C=CO2)C=CC(=O)O[C@@H]3C[C@@](C[C@H]([C@H]3O)O)(C(=O)O)O |
| InChI | InChI=1S/C19H20O9/c1-26-13-6-11-4-5-27-14(11)7-10(13)2-3-16(21)28-15-9-19(25,18(23)24)8-12(20)17(15)22/h2-7,12,15,17,20,22,25H,8-9H2,1H3,(H,23,24)/t12-,15-,17-,19+/m1/s1 |
| InChI Key | YSQPHHHONAVPLE-XKHMPKOFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O9 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.11073221 g/mol |
| Topological Polar Surface Area (TPSA) | 147.00 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
![2D Structure of (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[3-(5-methoxy-1-benzofuran-6-yl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/31c50b50-8339-11ee-8901-1fa7a77a0801.jpg "2D Structure of (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[3-(5-methoxy-1-benzofuran-6-yl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.60% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.63% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.22% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.43% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.47% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.14% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.40% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.47% | 90.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.63% | 89.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.84% | 91.19% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.60% | 95.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.47% | 99.23% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.44% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nicotiana tabacum |
| PubChem | 162985360 |
| LOTUS | LTS0099859 |
| wikiData | Q105360565 |