[3-acetyloxy-4-(2-acetyloxy-3-hydroxy-3-methylpent-4-enyl)-3,8,8-trimethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-4a-yl]methyl acetate
| Internal ID | df690299-ceaf-4d63-9de1-da5425ca997b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | [3-acetyloxy-4-(2-acetyloxy-3-hydroxy-3-methylpent-4-enyl)-3,8,8-trimethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-4a-yl]methyl acetate |
| SMILES (Canonical) | CC(=O)OCC12CCCC(C1CCC(C2CC(C(C)(C=C)O)OC(=O)C)(C)OC(=O)C)(C)C |
| SMILES (Isomeric) | CC(=O)OCC12CCCC(C1CCC(C2CC(C(C)(C=C)O)OC(=O)C)(C)OC(=O)C)(C)C |
| InChI | InChI=1S/C26H42O7/c1-9-24(7,30)22(32-18(3)28)15-21-25(8,33-19(4)29)14-11-20-23(5,6)12-10-13-26(20,21)16-31-17(2)27/h9,20-22,30H,1,10-16H2,2-8H3 |
| InChI Key | DAHUQEGQJYTVCS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.29305367 g/mol |
| Topological Polar Surface Area (TPSA) | 99.10 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.86% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.13% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.44% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.26% | 94.45% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.24% | 82.69% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.83% | 98.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.78% | 89.34% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.08% | 91.03% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.07% | 91.07% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.26% | 94.75% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.08% | 95.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.33% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.42% | 91.19% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.29% | 94.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.15% | 97.09% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 83.84% | 92.95% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.48% | 91.24% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.43% | 95.71% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.43% | 98.75% |
| CHEMBL5028 | O14672 | ADAM10 | 83.39% | 97.50% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.38% | 94.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.16% | 95.89% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.67% | 97.29% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.65% | 93.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.55% | 100.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.48% | 97.28% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.47% | 92.62% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.43% | 100.00% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 81.16% | 86.67% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.84% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ptychanthus striatus |
| PubChem | 73810076 |
| LOTUS | LTS0093084 |
| wikiData | Q104973574 |