Methyl 4-hydroxy-1,4a,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-2-carboxylate
Internal ID | 23917c23-9234-498a-8cbb-06cfc97c7aa5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | methyl 4-hydroxy-1,4a,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-2-carboxylate |
SMILES (Canonical) | CC1C(CC(C2(C1C3=CCC4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C)C)O)C(=O)OC |
SMILES (Isomeric) | CC1C(CC(C2(C1C3=CCC4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C)C)O)C(=O)OC |
InChI | InChI=1S/C31H48O4/c1-18-19(26(34)35-8)17-24(33)29(5)15-16-30(6)20(25(18)29)9-10-22-28(4)13-12-23(32)27(2,3)21(28)11-14-31(22,30)7/h9,18-19,21-22,24-25,33H,10-17H2,1-8H3 |
InChI Key | YQPSLCRGQUNTRC-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C31H48O4 |
Molecular Weight | 484.70 g/mol |
Exact Mass | 484.35526001 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 6.20 |
109974-21-2 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.63% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.85% | 96.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.60% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.11% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.49% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.34% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 85.92% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.45% | 99.23% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.41% | 90.71% |
CHEMBL4072 | P07858 | Cathepsin B | 82.40% | 93.67% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.19% | 85.30% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.01% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.53% | 94.45% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.15% | 93.03% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.53% | 90.17% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.40% | 91.07% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.12% | 95.38% |
CHEMBL5028 | O14672 | ADAM10 | 80.05% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tripterygium regelii |
Tripterygium wilfordii |
PubChem | 14466907 |
LOTUS | LTS0188027 |
wikiData | Q105352459 |