3,15-Dimethyl-5,14-dioxatetracyclo[6.6.1.02,6.012,15]pentadeca-2(6),3-diene-7,13-dione
| Internal ID | a8e5982d-dff8-4b70-9985-617c69215e84 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | 3,15-dimethyl-5,14-dioxatetracyclo[6.6.1.02,6.012,15]pentadeca-2(6),3-diene-7,13-dione |
| SMILES (Canonical) | CC1=COC2=C1C3C4(C(C2=O)CCCC4C(=O)O3)C |
| SMILES (Isomeric) | CC1=COC2=C1C3C4(C(C2=O)CCCC4C(=O)O3)C |
| InChI | InChI=1S/C15H16O4/c1-7-6-18-12-10(7)13-15(2)8(11(12)16)4-3-5-9(15)14(17)19-13/h6,8-9,13H,3-5H2,1-2H3 |
| InChI Key | DKIQWJSYQVPEGA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 56.50 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.08% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.69% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.52% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.82% | 92.94% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.38% | 92.50% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.70% | 96.21% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.57% | 95.89% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.39% | 93.04% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.45% | 96.38% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.62% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ligularia atroviolacea |
| PubChem | 162923925 |
| LOTUS | LTS0212512 |
| wikiData | Q104983309 |