4-[3-(3,5-Dihydroxyphenyl)-6-hydroxy-4-[2-(4-hydroxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-2-yl]benzene-1,3-diol
Internal ID | 8d576d52-c6d5-4230-849e-b5b85872ce35 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 4-[3-(3,5-dihydroxyphenyl)-6-hydroxy-4-[2-(4-hydroxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-2-yl]benzene-1,3-diol |
SMILES (Canonical) | C1=CC(=CC=C1C=CC2=C3C(C(OC3=CC(=C2)O)C4=C(C=C(C=C4)O)O)C5=CC(=CC(=C5)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C=CC2=C3C(C(OC3=CC(=C2)O)C4=C(C=C(C=C4)O)O)C5=CC(=CC(=C5)O)O)O |
InChI | InChI=1S/C28H22O7/c29-18-5-2-15(3-6-18)1-4-16-9-22(33)14-25-26(16)27(17-10-20(31)12-21(32)11-17)28(35-25)23-8-7-19(30)13-24(23)34/h1-14,27-34H |
InChI Key | KYXFGKLZVUDIIX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H22O7 |
Molecular Weight | 470.50 g/mol |
Exact Mass | 470.13655304 g/mol |
Topological Polar Surface Area (TPSA) | 131.00 Ų |
XlogP | 5.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.90% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.28% | 93.99% |
CHEMBL3194 | P02766 | Transthyretin | 96.41% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.15% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.47% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.41% | 86.33% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.72% | 89.67% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 86.51% | 98.35% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.00% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.91% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.83% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.81% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 83.63% | 98.95% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.17% | 96.12% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.37% | 89.44% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.28% | 91.71% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.07% | 93.40% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 81.56% | 96.42% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.48% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gnetum hainanense |
PubChem | 78384991 |
LOTUS | LTS0245845 |
wikiData | Q105148003 |