[(2S,3S,4S,5R,6S)-4-[(2S,3R,4S,5R)-4-acetyloxy-3,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-6-[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-2-methyloxan-3-yl] acetate
Internal ID | 277787ed-75cd-423b-8486-670a57428744 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(2S,3S,4S,5R,6S)-4-[(2S,3R,4S,5R)-4-acetyloxy-3,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-6-[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-2-methyloxan-3-yl] acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)OC4C(C(C(C(O4)CO)O)O)O)O)C5=CC=C(C=C5)OC)O)OC6C(C(C(CO6)O)OC(=O)C)O)OC(=O)C |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)C5=CC=C(C=C5)OC)O)O[C@H]6[C@@H]([C@H]([C@@H](CO6)O)OC(=O)C)O)OC(=O)C |
InChI | InChI=1S/C42H52O21/c1-16(2)7-12-22-25(59-41-31(51)30(50)28(48)26(14-43)60-41)13-23(46)27-29(49)38(35(61-36(22)27)20-8-10-21(54-6)11-9-20)63-42-33(53)39(34(17(3)56-42)57-18(4)44)62-40-32(52)37(58-19(5)45)24(47)15-55-40/h7-11,13,17,24,26,28,30-34,37,39-43,46-48,50-53H,12,14-15H2,1-6H3/t17-,24+,26+,28+,30-,31+,32+,33+,34-,37-,39-,40-,41+,42-/m0/s1 |
InChI Key | NKJJMKATLZNGPP-WDMHTFTOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C42H52O21 |
Molecular Weight | 892.80 g/mol |
Exact Mass | 892.30010866 g/mol |
Topological Polar Surface Area (TPSA) | 305.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of [(2S,3S,4S,5R,6S)-4-[(2S,3R,4S,5R)-4-acetyloxy-3,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-6-[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-2-methyloxan-3-yl] acetate 2D Structure of [(2S,3S,4S,5R,6S)-4-[(2S,3R,4S,5R)-4-acetyloxy-3,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-6-[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-2-methyloxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/30690c20-8670-11ee-8921-0f621100af7b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.92% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.00% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.68% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.55% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.63% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.62% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.53% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.97% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.20% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.34% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.24% | 99.15% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.94% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.44% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.01% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.77% | 94.73% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.57% | 95.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.08% | 92.94% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.79% | 95.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.70% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.39% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.38% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.75% | 91.49% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.77% | 94.42% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.44% | 92.62% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 80.84% | 87.67% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.14% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Epimedium sempervirens |
PubChem | 14429512 |
LOTUS | LTS0071531 |
wikiData | Q105180619 |