2-[3-Hydroxy-2-[2-hydroxy-4-(3-hydroxypropyl)phenoxy]-1-(4-hydroxy-3-methoxyphenyl)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 1e49216e-62c5-4644-8951-6b5f89fcd981 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 2-[3-hydroxy-2-[2-hydroxy-4-(3-hydroxypropyl)phenoxy]-1-(4-hydroxy-3-methoxyphenyl)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=C(C=CC(=C1)C(C(CO)OC2=C(C=C(C=C2)CCCO)O)OC3C(C(C(C(O3)CO)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C(C(CO)OC2=C(C=C(C=C2)CCCO)O)OC3C(C(C(C(O3)CO)O)O)O)O |
InChI | InChI=1S/C25H34O12/c1-34-18-10-14(5-6-15(18)29)24(37-25-23(33)22(32)21(31)19(11-27)36-25)20(12-28)35-17-7-4-13(3-2-8-26)9-16(17)30/h4-7,9-10,19-33H,2-3,8,11-12H2,1H3 |
InChI Key | BGHJPAAKWMIBKL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H34O12 |
Molecular Weight | 526.50 g/mol |
Exact Mass | 526.20502652 g/mol |
Topological Polar Surface Area (TPSA) | 199.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.19% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.51% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.80% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.38% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.63% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.72% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.64% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.60% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.19% | 94.45% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.88% | 95.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.84% | 96.00% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 85.43% | 90.20% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.54% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.71% | 95.56% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 82.43% | 97.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.87% | 90.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.76% | 89.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.45% | 99.15% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.28% | 100.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.19% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Picea abies |
Pinus massoniana |
Pinus sylvestris |
Viburnum dilatatum |
PubChem | 162892256 |
LOTUS | LTS0218027 |
wikiData | Q104935556 |