[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4R,6R)-6-[(3S,7S,8S,9R,10S,13R,14S,17R)-3,7-diacetyloxy-9-formyl-4,4,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-oxohept-1-en-4-yl]oxyoxan-2-yl]methyl acetate
Internal ID | 762ac925-bf04-4326-9a2d-13041f0c67c0 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4R,6R)-6-[(3S,7S,8S,9R,10S,13R,14S,17R)-3,7-diacetyloxy-9-formyl-4,4,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-oxohept-1-en-4-yl]oxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC(CC(C(=O)C(=C)C)OC1C(C(C(C(O1)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)C2CCC3(C2(CCC4(C3C(C=C5C4CCC(C5(C)C)OC(=O)C)OC(=O)C)C=O)C)C |
SMILES (Isomeric) | C[C@H](C[C@H](C(=O)C(=C)C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)[C@H]2CC[C@@]3([C@@]2(CC[C@@]4([C@H]3[C@H](C=C5[C@@H]4CC[C@@H](C5(C)C)OC(=O)C)OC(=O)C)C=O)C)C |
InChI | InChI=1S/C48H68O16/c1-24(2)39(56)35(63-44-42(62-31(9)55)41(61-30(8)54)40(60-29(7)53)37(64-44)22-57-26(4)50)20-25(3)32-16-17-47(13)43-36(58-27(5)51)21-34-33(48(43,23-49)19-18-46(32,47)12)14-15-38(45(34,10)11)59-28(6)52/h21,23,25,32-33,35-38,40-44H,1,14-20,22H2,2-13H3/t25-,32-,33+,35-,36+,37-,38+,40-,41+,42-,43+,44-,46-,47+,48-/m1/s1 |
InChI Key | VGWRISXHEOSJIZ-MXELFYQFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H68O16 |
Molecular Weight | 901.00 g/mol |
Exact Mass | 900.45073608 g/mol |
Topological Polar Surface Area (TPSA) | 210.00 Ų |
XlogP | 5.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.72% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.91% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.89% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.37% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.35% | 95.56% |
CHEMBL268 | P43235 | Cathepsin K | 87.07% | 96.85% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.98% | 91.19% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.97% | 90.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.41% | 92.62% |
CHEMBL5028 | O14672 | ADAM10 | 86.25% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.75% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.05% | 91.49% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.34% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.12% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.77% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.66% | 92.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.35% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.85% | 98.95% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.83% | 93.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.49% | 98.05% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.39% | 94.73% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.06% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 163195330 |
LOTUS | LTS0102866 |
wikiData | Q105286154 |