(1R,2R,3S,4R,6aS,6bR,12aR,14S)-1,2,3,4,6a,6b,9,9,12a-nonamethyl-3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydro-2H-picene-1,10,14-triol
| Internal ID | 6787b96c-418d-4964-ae06-8471b464cd27 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
| IUPAC Name | (1R,2R,3S,4R,6aS,6bR,12aR,14S)-1,2,3,4,6a,6b,9,9,12a-nonamethyl-3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14-tetradecahydro-2H-picene-1,10,14-triol |
| SMILES (Canonical) | CC1C(C2CCC3(C(=C2C(C1C)(C)O)C(CC4C3(CCC5C4(CCC(C5(C)C)O)C)C)O)C)C |
| SMILES (Isomeric) | C[C@H]1[C@H](C2CC[C@@]3(C(=C2[C@]([C@@H]1C)(C)O)[C@H](CC4[C@]3(CCC5[C@@]4(CCC(C5(C)C)O)C)C)O)C)C |
| InChI | InChI=1S/C31H52O3/c1-17-18(2)20-10-14-30(8)26(25(20)31(9,34)19(17)3)21(32)16-23-28(6)13-12-24(33)27(4,5)22(28)11-15-29(23,30)7/h17-24,32-34H,10-16H2,1-9H3/t17-,18+,19+,20?,21-,22?,23?,24?,28-,29+,30+,31+/m0/s1 |
| InChI Key | KXFYBGZZEMVXCE-HYASIDGLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.39164552 g/mol |
| Topological Polar Surface Area (TPSA) | 60.70 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.56% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.65% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.89% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.74% | 82.69% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.87% | 100.00% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 89.71% | 97.64% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.49% | 97.79% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.23% | 90.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.83% | 92.94% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.39% | 91.11% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 84.89% | 85.30% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.51% | 95.89% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 81.27% | 91.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ilex kaushue |
| PubChem | 5318854 |
| LOTUS | LTS0079658 |
| wikiData | Q105147311 |