(1R,2S,3R,5R,6S,9R,10R,13R,15S)-6-[(2E,4S)-4,5-dihydroxy-6-methylhepta-2,6-dien-2-yl]-9,10,14,14-tetramethyl-16-oxapentacyclo[13.2.2.01,13.02,10.05,9]nonadecane-3,15-diol
Internal ID | 127b01d4-c08d-418e-84b1-d10af52a73d4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,2S,3R,5R,6S,9R,10R,13R,15S)-6-[(2E,4S)-4,5-dihydroxy-6-methylhepta-2,6-dien-2-yl]-9,10,14,14-tetramethyl-16-oxapentacyclo[13.2.2.01,13.02,10.05,9]nonadecane-3,15-diol |
SMILES (Canonical) | CC(=C)C(C(C=C(C)C1CCC2(C1CC(C3C2(CCC4C35CCC(C4(C)C)(OC5)O)C)O)C)O)O |
SMILES (Isomeric) | CC(=C)C([C@H](/C=C(\C)/[C@H]1CC[C@@]2([C@@H]1C[C@H]([C@H]3[C@]2(CC[C@@H]4[C@]35CC[C@@](C4(C)C)(OC5)O)C)O)C)O)O |
InChI | InChI=1S/C30H48O5/c1-17(2)24(33)21(31)14-18(3)19-8-10-27(6)20(19)15-22(32)25-28(27,7)11-9-23-26(4,5)30(34)13-12-29(23,25)16-35-30/h14,19-25,31-34H,1,8-13,15-16H2,2-7H3/b18-14+/t19-,20-,21+,22-,23+,24?,25+,27-,28-,29-,30+/m1/s1 |
InChI Key | YVVPJOHKSHNHKP-FLKORALXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O5 |
Molecular Weight | 488.70 g/mol |
Exact Mass | 488.35017463 g/mol |
Topological Polar Surface Area (TPSA) | 90.20 Ų |
XlogP | 5.40 |
There are no found synonyms. |
![2D Structure of (1R,2S,3R,5R,6S,9R,10R,13R,15S)-6-[(2E,4S)-4,5-dihydroxy-6-methylhepta-2,6-dien-2-yl]-9,10,14,14-tetramethyl-16-oxapentacyclo[13.2.2.01,13.02,10.05,9]nonadecane-3,15-diol 2D Structure of (1R,2S,3R,5R,6S,9R,10R,13R,15S)-6-[(2E,4S)-4,5-dihydroxy-6-methylhepta-2,6-dien-2-yl]-9,10,14,14-tetramethyl-16-oxapentacyclo[13.2.2.01,13.02,10.05,9]nonadecane-3,15-diol](https://plantaedb.com/storage/docs/compounds/2023/11/303a1c10-8798-11ee-88f0-4fbf44537c5a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.40% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.85% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.19% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.30% | 94.45% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.35% | 96.38% |
CHEMBL233 | P35372 | Mu opioid receptor | 90.61% | 97.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.10% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.09% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.87% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.78% | 97.14% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 88.57% | 95.58% |
CHEMBL268 | P43235 | Cathepsin K | 88.19% | 96.85% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 87.30% | 95.38% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.69% | 82.69% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.59% | 82.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.47% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 84.80% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.65% | 85.14% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 83.77% | 97.64% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.62% | 91.03% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.25% | 91.19% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.61% | 94.75% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.55% | 96.39% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.10% | 89.50% |
CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 80.68% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Varronia multispicata |
PubChem | 101262421 |
LOTUS | LTS0075479 |
wikiData | Q105366072 |