3-(sec-Butyl)-2-methoxy-5-methylpyrazine
| Internal ID | 15319b39-2b83-4d85-862c-0f67cd825fa1 |
| Taxonomy | Organoheterocyclic compounds > Diazines > Pyrazines > Methoxypyrazines |
| IUPAC Name | 3-butan-2-yl-2-methoxy-5-methylpyrazine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H16N2O/c1-5-7(2)9-10(13-4)11-6-8(3)12-9/h6-7H,5H2,1-4H3 |
| InChI Key | VPZHXSRAUPOUQO-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.126263138 g/mol |
| Topological Polar Surface Area (TPSA) | 35.00 Ų |
| XlogP | 2.00 |
| 3-sec-Butyl-2-methoxy-5-methylpyrazine |
| 3-(sec-Butyl)-2-methoxy-5-methylpyrazine |
| 3-butan-2-yl-2-methoxy-5-methylpyrazine |
| 2-METHOXY-5-METHYL-3-(1-METHYLPROPYL)PYRAZINE |
| 3-(Butan-2-yl)-2-methoxy-5-methylpyrazine |
| DTXSID50575258 |
| VPZHXSRAUPOUQO-UHFFFAOYSA-N |
| 3-s-butyl-2-methoxy-5-methyl pyrazine |
| F11692 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.81% | 94.75% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 92.17% | 85.30% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.34% | 96.09% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 86.73% | 92.68% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.59% | 94.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.57% | 93.65% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.89% | 96.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 85.78% | 97.47% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 85.16% | 87.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.94% | 99.17% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 83.93% | 95.39% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.87% | 94.73% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.52% | 97.21% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.27% | 97.36% |
| CHEMBL1741186 | P51449 | Nuclear receptor ROR-gamma | 83.11% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.73% | 98.95% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.93% | 93.10% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.78% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.56% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.29% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Panax ginseng |
| PubChem | 15590167 |
| LOTUS | LTS0211498 |
| wikiData | Q72490496 |