3-Phenylbenzaldehyde
| Internal ID | 02544a70-75af-4a2e-8e6d-81959ca85c70 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
| IUPAC Name | 3-phenylbenzaldehyde |
| SMILES (Canonical) | C1=CC=C(C=C1)C2=CC=CC(=C2)C=O |
| SMILES (Isomeric) | C1=CC=C(C=C1)C2=CC=CC(=C2)C=O |
| InChI | InChI=1S/C13H10O/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-10H |
| InChI Key | KFKSIUOALVIACE-UHFFFAOYSA-N |
| Popularity | 25 references in papers |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.073164938 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 3.40 |
| 1204-60-0 |
| [1,1'-biphenyl]-3-carbaldehyde |
| Biphenyl-3-carbaldehyde |
| BIPHENYL-3-CARBOXALDEHYDE |
| 3-Difenilaldeide |
| 3-FORMYLBIPHENYL |
| 3-Biphenyl carboxaldehyde |
| 3-Difenilaldeide [Italian] |
| 1,1'-biphenyl-3-carbaldehyde |
| 3-biphenylcarboxaldehyde |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.29% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.71% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.61% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.29% | 98.95% |
| CHEMBL240 | Q12809 | HERG | 90.91% | 89.76% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.46% | 92.08% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.80% | 94.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.82% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.26% | 96.00% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.25% | 94.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zingiber officinale |
| PubChem | 121053 |
| LOTUS | LTS0067525 |
| wikiData | Q72501311 |