3'-O-demethyl-4'-N-demethyl-4'-N-acetyl-4'-epi-staurosporine
| Internal ID | 7b2342f3-6671-457b-a020-b753d00e00b0 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles > Pyrrolocarbazoles > Indolocarbazoles |
| IUPAC Name | N-[(2S,3R,4R,6R)-3-hydroxy-2-methyl-16-oxo-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8,10,12,14,19,21,23,25,27-nonaen-4-yl]acetamide |
| SMILES (Canonical) | CC(=O)NC1CC2N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N(C7=C53)C(C1O)(O2)C)CNC6=O |
| SMILES (Isomeric) | CC(=O)N[C@@H]1C[C@@H]2N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N(C7=C53)[C@]([C@@H]1O)(O2)C)CNC6=O |
| InChI | InChI=1S/C28H24N4O4/c1-13(33)30-17-11-20-31-18-9-5-3-7-14(18)22-23-16(12-29-27(23)35)21-15-8-4-6-10-19(15)32(25(21)24(22)31)28(2,36-20)26(17)34/h3-10,17,20,26,34H,11-12H2,1-2H3,(H,29,35)(H,30,33)/t17-,20-,26-,28+/m1/s1 |
| InChI Key | PTQKRNULLCXNRU-FYTWVXJKSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.17975526 g/mol |
| Topological Polar Surface Area (TPSA) | 97.50 Ų |
| XlogP | 2.40 |
| Atomic LogP (AlogP) | 3.62 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 3 |
| Rotatable Bonds | 1 |
| N-[(2S,3R,4R,6R)-3-hydroxy-2-methyl-16-oxo-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8,10,12,14,19,21,23,25,27-nonaen-4-yl]acetamide |
| N-((2S,3R,4R,6R)-3,16-Dihydroxy-2-methyl-29-oxa-1,7,17-triazaoctacyclo(12.12.2.1,.0,.0,.0,.0,.0,)nonacosa-8,10,12,14,16,19,21,23,25,27-decaen-4-yl)ethanimidate |
| N-((2S,3R,4R,6R)-3-hydroxy-2-methyl-16-oxo-29-oxa-1,7,17-triazaoctacyclo(12.12.2.12,6.07,28.08,13.015,19.020,27.021,26)nonacosa-8,10,12,14,19,21,23,25,27-nonaen-4-yl)acetamide |
| N-((2S,3R,4S,6R)-3-hydroxy-2-methyl-16-oxo-29-oxa-1,7,17-triazaoctacyclo(12.12.2.12,6.07,28.08,13.015,19.020,27.021,26)nonacosa-8,10,12,14,19,21,23,25,27-nonaen-4-yl)acetamide |
| N-[(2S,3R,4R,6R)-3,16-Dihydroxy-2-methyl-29-oxa-1,7,17-triazaoctacyclo[12.12.2.1,.0,.0,.0,.0,.0,]nonacosa-8,10,12,14,16,19,21,23,25,27-decaen-4-yl]ethanimidate |
| N-[(2S,3R,4S,6R)-3-hydroxy-2-methyl-16-oxo-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8,10,12,14,19,21,23,25,27-nonaen-4-yl]acetamide |
| RefChem:90497 |
| CHEMBL4202716 |
| CHEBI:209166 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.6163 | 61.63% |
| Caco-2 | - | 0.8573 | 85.73% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.5286 | 52.86% |
| Subcellular localzation | Nucleus | 0.3658 | 36.58% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8739 | 87.39% |
| OATP1B3 inhibitior | + | 0.9411 | 94.11% |
| MATE1 inhibitior | - | 0.7200 | 72.00% |
| OCT2 inhibitior | - | 0.9316 | 93.16% |
| BSEP inhibitior | + | 0.9643 | 96.43% |
| P-glycoprotein inhibitior | + | 0.6198 | 61.98% |
| P-glycoprotein substrate | + | 0.8745 | 87.45% |
| CYP3A4 substrate | + | 0.6993 | 69.93% |
| CYP2C9 substrate | - | 0.8005 | 80.05% |
| CYP2D6 substrate | - | 0.8560 | 85.60% |
| CYP3A4 inhibition | - | 0.8528 | 85.28% |
| CYP2C9 inhibition | - | 0.6906 | 69.06% |
| CYP2C19 inhibition | - | 0.7835 | 78.35% |
| CYP2D6 inhibition | - | 0.9076 | 90.76% |
| CYP1A2 inhibition | - | 0.8352 | 83.52% |
| CYP2C8 inhibition | + | 0.6002 | 60.02% |
| CYP inhibitory promiscuity | - | 0.7907 | 79.07% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8800 | 88.00% |
| Carcinogenicity (trinary) | Non-required | 0.6035 | 60.35% |
| Eye corrosion | - | 0.9903 | 99.03% |
| Eye irritation | - | 0.9801 | 98.01% |
| Skin irritation | - | 0.7952 | 79.52% |
| Skin corrosion | - | 0.9396 | 93.96% |
| Ames mutagenesis | + | 0.6082 | 60.82% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4050 | 40.50% |
| Micronuclear | + | 0.8800 | 88.00% |
| Hepatotoxicity | + | 0.7039 | 70.39% |
| skin sensitisation | - | 0.8757 | 87.57% |
| Respiratory toxicity | + | 0.9111 | 91.11% |
| Reproductive toxicity | + | 1.0000 | 100.00% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | + | 0.6183 | 61.83% |
| Acute Oral Toxicity (c) | III | 0.5652 | 56.52% |
| Estrogen receptor binding | + | 0.6735 | 67.35% |
| Androgen receptor binding | + | 0.6166 | 61.66% |
| Thyroid receptor binding | + | 0.5155 | 51.55% |
| Glucocorticoid receptor binding | + | 0.7965 | 79.65% |
| Aromatase binding | + | 0.5505 | 55.05% |
| PPAR gamma | + | 0.7796 | 77.96% |
| Honey bee toxicity | - | 0.7760 | 77.60% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
| Fish aquatic toxicity | - | 0.5851 | 58.51% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 |
770 nM |
IC50 |
via Super-PRED
|
| CHEMBL299 | P17252 | Protein kinase C alpha |
92 nM |
IC50 |
via Super-PRED
|
| CHEMBL2973 | O75116 | Rho-associated protein kinase 2 |
260 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.56% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.41% | 91.11% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 98.89% | 83.10% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 98.86% | 81.14% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 98.69% | 80.71% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 98.26% | 87.16% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 98.23% | 88.81% |
| CHEMBL4924 | Q9UK32 | Ribosomal protein S6 kinase alpha 6 | 97.90% | 80.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.79% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.76% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.54% | 96.09% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 97.24% | 85.11% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 97.22% | 85.30% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 96.92% | 89.23% |
| CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 96.85% | 90.48% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 96.62% | 91.79% |
| CHEMBL4598 | Q13043 | Serine/threonine-protein kinase MST1 | 96.37% | 96.64% |
| CHEMBL2801 | Q13557 | CaM kinase II delta | 95.88% | 84.49% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 94.92% | 80.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.62% | 98.95% |
| CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 94.47% | 83.65% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.87% | 95.56% |
| CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 93.75% | 95.42% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 93.57% | 95.64% |
| CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 93.48% | 91.83% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 93.19% | 93.03% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 93.17% | 98.59% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 92.92% | 96.47% |
| CHEMBL4599 | Q07912 | Tyrosine kinase non-receptor protein 2 | 92.51% | 94.29% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 91.74% | 97.03% |
| CHEMBL4237 | O75582 | Ribosomal protein S6 kinase alpha 5 | 91.27% | 91.00% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 91.17% | 81.58% |
| CHEMBL2185 | Q96GD4 | Serine/threonine-protein kinase Aurora-B | 91.10% | 96.80% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 90.51% | 95.83% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 90.40% | 91.38% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.35% | 99.23% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.08% | 96.00% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 87.51% | 88.00% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 87.51% | 90.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.36% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.24% | 91.07% |
| CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 86.94% | 96.00% |
| CHEMBL1936 | P10721 | Stem cell growth factor receptor | 86.71% | 84.17% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.51% | 91.24% |
| CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 86.14% | 95.52% |
| CHEMBL3529 | Q14164 | Inhibitor of nuclear factor kappa B kinase epsilon subunit | 84.80% | 98.19% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.42% | 90.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.20% | 93.99% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.67% | 91.03% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 83.14% | 96.39% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.31% | 97.09% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 81.16% | 82.50% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.08% | 92.88% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.82% | 90.08% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.70% | 97.14% |
| CHEMBL2094128 | P24941 | Cyclin-dependent kinase 2/cyclin A | 80.68% | 97.25% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 80.33% | 88.84% |
| CHEMBL2599 | P43405 | Tyrosine-protein kinase SYK | 80.09% | 97.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589943 |
| LOTUS | LTS0226559 |
| wikiData | Q105214832 |