3'-N-formyl-holyrine A
| Internal ID | dd4c82e1-87df-4032-8132-eb843a835192 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles > Pyrrolocarbazoles > Indolocarbazoles |
| IUPAC Name | N-[(2S,3R,4R,6R)-3-hydroxy-2-methyl-6-(12-oxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)oxan-4-yl]formamide |
| SMILES (Canonical) | CC1C(C(CC(O1)N2C3=CC=CC=C3C4=C5C(=C6C7=CC=CC=C7NC6=C42)CNC5=O)NC=O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H](C[C@@H](O1)N2C3=CC=CC=C3C4=C5C(=C6C7=CC=CC=C7NC6=C42)CNC5=O)NC=O)O |
| InChI | InChI=1S/C27H24N4O4/c1-13-26(33)18(29-12-32)10-20(35-13)31-19-9-5-3-7-15(19)22-23-16(11-28-27(23)34)21-14-6-2-4-8-17(14)30-24(21)25(22)31/h2-9,12-13,18,20,26,30,33H,10-11H2,1H3,(H,28,34)(H,29,32)/t13-,18+,20+,26-/m0/s1 |
| InChI Key | PWDMDSRARYDKBY-VCPAMCLESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.17975526 g/mol |
| Topological Polar Surface Area (TPSA) | 108.00 Ų |
| XlogP | 2.90 |
| Atomic LogP (AlogP) | 3.46 |
| H-Bond Acceptor | 5 |
| H-Bond Donor | 4 |
| Rotatable Bonds | 3 |
| N-((2S,3R,4R,6R)-3-hydroxy-2-methyl-6-(12-oxo-3,13,23-triazahexacyclo(14.7.0.02,10.04,9.011,15.017,22)tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)oxan-4-yl)formamide |
| N-[(2S,3R,4R,6R)-3-hydroxy-2-methyl-6-(12-oxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)oxan-4-yl]formamide |
| RefChem:90470 |
| CHEMBL4741653 |
| 3'-N-formyl- holyrine A |
| CHEBI:214982 |
| BDBM50547731 |
| N-[(2S,3R,4R,6R)-3-hydroxy-2-methyl-6-(12-oxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)oxan-4-yl]ormamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6392 | 63.92% |
| Caco-2 | - | 0.7603 | 76.03% |
| Blood Brain Barrier | - | 0.5250 | 52.50% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.4183 | 41.83% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8705 | 87.05% |
| OATP1B3 inhibitior | + | 0.9399 | 93.99% |
| MATE1 inhibitior | - | 0.8009 | 80.09% |
| OCT2 inhibitior | - | 0.9206 | 92.06% |
| BSEP inhibitior | + | 0.9845 | 98.45% |
| P-glycoprotein inhibitior | + | 0.7778 | 77.78% |
| P-glycoprotein substrate | + | 0.7252 | 72.52% |
| CYP3A4 substrate | + | 0.6745 | 67.45% |
| CYP2C9 substrate | - | 0.8027 | 80.27% |
| CYP2D6 substrate | - | 0.8500 | 85.00% |
| CYP3A4 inhibition | - | 0.9305 | 93.05% |
| CYP2C9 inhibition | - | 0.5717 | 57.17% |
| CYP2C19 inhibition | - | 0.8197 | 81.97% |
| CYP2D6 inhibition | - | 0.9160 | 91.60% |
| CYP1A2 inhibition | - | 0.8980 | 89.80% |
| CYP2C8 inhibition | + | 0.6200 | 62.00% |
| CYP inhibitory promiscuity | - | 0.8129 | 81.29% |
| UGT catelyzed | - | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8900 | 89.00% |
| Carcinogenicity (trinary) | Non-required | 0.6030 | 60.30% |
| Eye corrosion | - | 0.9911 | 99.11% |
| Eye irritation | - | 0.9907 | 99.07% |
| Skin irritation | - | 0.8054 | 80.54% |
| Skin corrosion | - | 0.9449 | 94.49% |
| Ames mutagenesis | + | 0.7136 | 71.36% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7524 | 75.24% |
| Micronuclear | + | 0.8800 | 88.00% |
| Hepatotoxicity | + | 0.6461 | 64.61% |
| skin sensitisation | - | 0.8976 | 89.76% |
| Respiratory toxicity | + | 0.8556 | 85.56% |
| Reproductive toxicity | + | 0.9778 | 97.78% |
| Mitochondrial toxicity | + | 0.8625 | 86.25% |
| Nephrotoxicity | - | 0.7144 | 71.44% |
| Acute Oral Toxicity (c) | III | 0.6012 | 60.12% |
| Estrogen receptor binding | + | 0.7316 | 73.16% |
| Androgen receptor binding | + | 0.6490 | 64.90% |
| Thyroid receptor binding | + | 0.5419 | 54.19% |
| Glucocorticoid receptor binding | + | 0.6914 | 69.14% |
| Aromatase binding | + | 0.5529 | 55.29% |
| PPAR gamma | + | 0.6686 | 66.86% |
| Honey bee toxicity | - | 0.8041 | 80.41% |
| Biodegradation | - | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | + | 0.5400 | 54.00% |
| Fish aquatic toxicity | - | 0.5890 | 58.90% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 99.14% | 81.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.42% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.32% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.84% | 95.56% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 97.47% | 87.16% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.22% | 94.45% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 96.28% | 83.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.05% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.02% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.05% | 93.99% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 94.83% | 98.59% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.79% | 85.14% |
| CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 94.34% | 91.83% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 93.08% | 80.96% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 92.21% | 85.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.89% | 91.49% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.78% | 90.08% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 91.49% | 88.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 90.83% | 85.30% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 90.60% | 80.71% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 90.11% | 81.58% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.98% | 99.23% |
| CHEMBL4924 | Q9UK32 | Ribosomal protein S6 kinase alpha 6 | 89.40% | 80.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.39% | 93.03% |
| CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 89.33% | 83.65% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 89.08% | 97.03% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.77% | 90.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 88.59% | 98.03% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 88.45% | 96.39% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 87.88% | 88.56% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 87.36% | 96.00% |
| CHEMBL1936 | P10721 | Stem cell growth factor receptor | 87.19% | 84.17% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.22% | 95.64% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.99% | 97.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.78% | 94.73% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 84.76% | 89.44% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 84.74% | 80.00% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 83.53% | 96.47% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 82.71% | 91.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.71% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.34% | 86.33% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 82.09% | 89.32% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.43% | 95.83% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.21% | 91.79% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.06% | 97.09% |
| CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 80.13% | 95.52% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.01% | 97.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683948 |
| LOTUS | LTS0232684 |
| wikiData | Q105215775 |