3-Methylellagic acid 8-(2-acetylrhamnoside)
Internal ID | 605a903d-f0bc-4fb3-bd39-8576956f85ba |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [2-[(6,13-dihydroxy-14-methoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(C=C3C4=C2OC(=O)C5=CC(=C(C(=C54)OC3=O)OC)O)O)OC(=O)C)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(C=C3C4=C2OC(=O)C5=CC(=C(C(=C54)OC3=O)OC)O)O)OC(=O)C)O)O |
InChI | InChI=1S/C23H20O13/c1-6-14(27)15(28)20(33-7(2)24)23(32-6)36-17-11(26)5-9-13-12-8(22(30)35-19(13)17)4-10(25)16(31-3)18(12)34-21(9)29/h4-6,14-15,20,23,25-28H,1-3H3 |
InChI Key | XOBMJVRDRZBSBR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H20O13 |
Molecular Weight | 504.40 g/mol |
Exact Mass | 504.09039069 g/mol |
Topological Polar Surface Area (TPSA) | 188.00 Ų |
XlogP | 0.70 |
CHEBI:168439 |
[2-[(6,13-dihydroxy-14-methoxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl)oxy]-4,5-dihydroxy-6-methyloxan-3-yl] acetate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.63% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.26% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.08% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.31% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.16% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.73% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.97% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.04% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.32% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.47% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.14% | 99.17% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.05% | 94.80% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.03% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus globulus |
PubChem | 73157205 |
LOTUS | LTS0182566 |
wikiData | Q105337670 |