3-Methyladenine
| Internal ID | 8a3a3f18-8515-4810-ab08-4815ffe93d06 |
| Taxonomy | Organoheterocyclic compounds > Imidazopyrimidines > Purines and purine derivatives |
| IUPAC Name | 3-methyl-7H-purin-6-imine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C6H7N5/c1-11-3-10-5(7)4-6(11)9-2-8-4/h2-3,7H,1H3,(H,8,9) |
| InChI Key | ZPBYVFQJHWLTFB-UHFFFAOYSA-N |
| Popularity | 3,697 references in papers |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07014524 g/mol |
| Topological Polar Surface Area (TPSA) | 68.10 Ų |
| XlogP | -0.20 |
| 5142-23-4 |
| 3-Methyl-3H-purin-6-amine |
| 3-MA |
| 6-Amino-3-methylpurine |
| 3H-Purin-6-amine, 3-methyl- |
| 3-Methyl-3H-adenine |
| 3-methylpurin-6-amine |
| ADENINE, 3-METHYL- |
| NSC 66389 |
| C6H7N5 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.68% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.77% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.32% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.91% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.19% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.78% | 86.33% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.86% | 93.65% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.53% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sophora leachiana |
| PubChem | 135398661 |
| LOTUS | LTS0094054 |
| wikiData | Q105200443 |