3-Methyl-9H-carbazol-1-ol
Internal ID | 727d0e11-6cb9-4c38-b327-e6b666a998b1 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 3-methyl-9H-carbazol-1-ol |
SMILES (Canonical) | CC1=CC2=C(C(=C1)O)NC3=CC=CC=C32 |
SMILES (Isomeric) | CC1=CC2=C(C(=C1)O)NC3=CC=CC=C32 |
InChI | InChI=1S/C13H11NO/c1-8-6-10-9-4-2-3-5-11(9)14-13(10)12(15)7-8/h2-7,14-15H,1H3 |
InChI Key | IKITXHOOBOBUFJ-UHFFFAOYSA-N |
Popularity | 7 references in papers |
Molecular Formula | C13H11NO |
Molecular Weight | 197.23 g/mol |
Exact Mass | 197.084063974 g/mol |
Topological Polar Surface Area (TPSA) | 36.00 Ų |
XlogP | 3.40 |
1-hydroxy-3-methyl-9h-carbazole |
14960-81-7 |
1-hydroxy-3-methylcarbazole |
2,2'-(1,4-Phenylene)bis(5-phenyl-Oxazole |
2,2'-(1,4-Phenylene)bis[5-phenyl-Oxazole |
9H-Carbazol-1-ol, 3-methyl- |
Q5H4JS4F3D |
3-Methyl-9H-carbazol-1-ol # |
1-Hydroxy-3-methyl-9H-carbazol |
CHEBI:173545 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.47% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.27% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.43% | 91.49% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.19% | 94.75% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.28% | 93.99% |
CHEMBL2581 | P07339 | Cathepsin D | 91.62% | 98.95% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.87% | 94.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.39% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.29% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.93% | 94.73% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.92% | 91.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.94% | 96.09% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.84% | 95.56% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.82% | 85.49% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.29% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Murraya koenigii |
PubChem | 607542 |
LOTUS | LTS0077824 |
wikiData | Q105114669 |