3-Methyl-8,12-dimethylidene-4,14-dioxatricyclo[9.3.0.03,5]tetradecane-9,13-dione
| Internal ID | 739cd1f5-1ddf-4e73-b6ff-c3a61158b691 |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | 3-methyl-8,12-dimethylidene-4,14-dioxatricyclo[9.3.0.03,5]tetradecane-9,13-dione |
| SMILES (Canonical) | CC12CC3C(CC(=O)C(=C)CCC1O2)C(=C)C(=O)O3 |
| SMILES (Isomeric) | CC12CC3C(CC(=O)C(=C)CCC1O2)C(=C)C(=O)O3 |
| InChI | InChI=1S/C15H18O4/c1-8-4-5-13-15(3,19-13)7-12-10(6-11(8)16)9(2)14(17)18-12/h10,12-13H,1-2,4-7H2,3H3 |
| InChI Key | USIVAPDVUIPNDQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 55.90 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
![2D Structure of 3-Methyl-8,12-dimethylidene-4,14-dioxatricyclo[9.3.0.03,5]tetradecane-9,13-dione](https://plantaedb.com/storage/docs/compounds/2023/11/3-methyl-812-dimethylidene-414-dioxatricyclo930035tetradecane-913-dione.jpg "2D Structure of 3-Methyl-8,12-dimethylidene-4,14-dioxatricyclo[9.3.0.03,5]tetradecane-9,13-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.50% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.29% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.99% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.37% | 91.11% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 86.78% | 96.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.76% | 97.25% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.00% | 97.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.26% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.24% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.67% | 94.45% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.27% | 94.78% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.21% | 93.03% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.95% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.85% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.35% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calea szyszylowiczii |
| PubChem | 163005407 |
| LOTUS | LTS0080565 |
| wikiData | Q105278222 |