3-methyl-6,7-dihydro-5H-imidazo[1,2-a]pyridin-8-one
| Internal ID | 6ca31979-9d46-472b-a220-1b4cd885732d |
| Taxonomy | Organoheterocyclic compounds > Imidazopyridines > Imidazopyridinones |
| IUPAC Name | 3-methyl-6,7-dihydro-5H-imidazo[1,2-a]pyridin-8-one |
| SMILES (Canonical) | CC1=CN=C2N1CCCC2=O |
| SMILES (Isomeric) | CC1=CN=C2N1CCCC2=O |
| InChI | InChI=1S/C8H10N2O/c1-6-5-9-8-7(11)3-2-4-10(6)8/h5H,2-4H2,1H3 |
| InChI Key | QEGVGRBNBOFZRY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.079312947 g/mol |
| Topological Polar Surface Area (TPSA) | 34.90 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.74% | 93.40% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.45% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.57% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.95% | 94.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.99% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.85% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.75% | 86.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.78% | 90.08% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.19% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.17% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.10% | 99.23% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.70% | 93.65% |
| CHEMBL2094121 | P14867 | GABA-A receptor; alpha-1/beta-3/gamma-2 | 80.98% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Salvia miltiorrhiza |
| PubChem | 11804937 |
| LOTUS | LTS0098002 |
| wikiData | Q27135453 |