[3-Methyl-2-(3-methylbut-2-enyl)-6-phenylcyclohex-3-en-1-yl]-(2,4,6-trihydroxyphenyl)methanone
Internal ID | e39ae80f-a078-4b39-9a9f-6405bd87b92d |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | [3-methyl-2-(3-methylbut-2-enyl)-6-phenylcyclohex-3-en-1-yl]-(2,4,6-trihydroxyphenyl)methanone |
SMILES (Canonical) | CC1=CCC(C(C1CC=C(C)C)C(=O)C2=C(C=C(C=C2O)O)O)C3=CC=CC=C3 |
SMILES (Isomeric) | CC1=CCC(C(C1CC=C(C)C)C(=O)C2=C(C=C(C=C2O)O)O)C3=CC=CC=C3 |
InChI | InChI=1S/C25H28O4/c1-15(2)9-11-19-16(3)10-12-20(17-7-5-4-6-8-17)23(19)25(29)24-21(27)13-18(26)14-22(24)28/h4-10,13-14,19-20,23,26-28H,11-12H2,1-3H3 |
InChI Key | AYPOOQWQTQIRFW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O4 |
Molecular Weight | 392.50 g/mol |
Exact Mass | 392.19875937 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 5.60 |
There are no found synonyms. |
![2D Structure of [3-Methyl-2-(3-methylbut-2-enyl)-6-phenylcyclohex-3-en-1-yl]-(2,4,6-trihydroxyphenyl)methanone 2D Structure of [3-Methyl-2-(3-methylbut-2-enyl)-6-phenylcyclohex-3-en-1-yl]-(2,4,6-trihydroxyphenyl)methanone](https://plantaedb.com/storage/docs/compounds/2023/11/3-methyl-2-3-methylbut-2-enyl-6-phenylcyclohex-3-en-1-yl-246-trihydroxyphenylmethanone.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.15% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.13% | 98.95% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 94.89% | 96.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.80% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.83% | 94.73% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.69% | 97.21% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.44% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.63% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.59% | 90.17% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.36% | 94.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.83% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.30% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.23% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.90% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boesenbergia rotunda |
PubChem | 22297208 |
LOTUS | LTS0158184 |
wikiData | Q104921310 |