3-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol
| Internal ID | 0cc0e8ba-7ef2-468d-864e-fd50e15ab8c6 |
| Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
| IUPAC Name | 3-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H19NO2/c1-21-18-9-13-6-7-19-11-14-5-3-2-4-12(14)8-16(19)15(13)10-17(18)20/h2-5,9-10,16,20H,6-8,11H2,1H3 |
| InChI Key | FNYIPYRLIHJQLI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.141578849 g/mol |
| Topological Polar Surface Area (TPSA) | 32.70 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of 3-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/3-methoxy-681313a-tetrahydro-5h-isoquinolino21-bisoquinolin-2-ol.jpg "2D Structure of 3-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.37% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.91% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.20% | 98.95% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 94.57% | 95.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.87% | 95.56% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 92.96% | 91.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.61% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.42% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.11% | 93.99% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.03% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.48% | 89.62% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 85.44% | 91.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.83% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.00% | 98.75% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.22% | 82.38% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.09% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Argemone mexicana |
| PubChem | 10085118 |
| LOTUS | LTS0232953 |
| wikiData | Q104998613 |