3-methoxy-6-methyl-9H-carbazole-1-carbaldehyde
| Internal ID | e234cf07-f97e-4d76-b6a8-bb6f0a72dcc9 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 3-methoxy-6-methyl-9H-carbazole-1-carbaldehyde |
| SMILES (Canonical) | CC1=CC2=C(C=C1)NC3=C(C=C(C=C23)OC)C=O |
| SMILES (Isomeric) | CC1=CC2=C(C=C1)NC3=C(C=C(C=C23)OC)C=O |
| InChI | InChI=1S/C15H13NO2/c1-9-3-4-14-12(5-9)13-7-11(18-2)6-10(8-17)15(13)16-14/h3-8,16H,1-2H3 |
| InChI Key | ILZFAWHFXKCNEY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.094628657 g/mol |
| Topological Polar Surface Area (TPSA) | 42.10 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.46% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.87% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.53% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.51% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.25% | 96.09% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.72% | 91.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.49% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.49% | 96.00% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.01% | 85.49% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.35% | 98.11% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.51% | 98.59% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.34% | 98.95% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 84.07% | 93.24% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.74% | 85.30% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.55% | 93.31% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.94% | 93.18% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.88% | 94.80% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.35% | 98.75% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 82.04% | 96.47% |
| CHEMBL3650 | P11362 | Fibroblast growth factor receptor 1 | 80.70% | 98.47% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.31% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Murraya koenigii |
| PubChem | 11010048 |
| LOTUS | LTS0131381 |
| wikiData | Q105115559 |