3-methoxy-5-[(E)-2-phenylethenyl]benzene-1,2-diol
| Internal ID | 49e848d1-d423-4b9b-8aa7-28a75b8f985e |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 3-methoxy-5-[(E)-2-phenylethenyl]benzene-1,2-diol |
| SMILES (Canonical) | COC1=CC(=CC(=C1O)O)C=CC2=CC=CC=C2 |
| SMILES (Isomeric) | COC1=CC(=CC(=C1O)O)/C=C/C2=CC=CC=C2 |
| InChI | InChI=1S/C15H14O3/c1-18-14-10-12(9-13(16)15(14)17)8-7-11-5-3-2-4-6-11/h2-10,16-17H,1H3/b8-7+ |
| InChI Key | WBBHYMRWGHBXLS-BQYQJAHWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 3.50 |
| SCHEMBL3645729 |
| ACon1_000674 |
| DTXSID501341856 |
| NCGC00169470-01 |
| 3-methoxy-5-[(E)-2-phenylethenyl]benzene-1,2-diol |
![2D Structure of 3-methoxy-5-[(E)-2-phenylethenyl]benzene-1,2-diol](https://plantaedb.com/storage/docs/compounds/2023/11/3-methoxy-5-e-2-phenylethenylbenzene-12-diol.jpg "2D Structure of 3-methoxy-5-[(E)-2-phenylethenyl]benzene-1,2-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.05% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.82% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.02% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 92.00% | 90.71% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 88.00% | 94.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.35% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.50% | 93.99% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.09% | 90.20% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.62% | 89.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.55% | 94.73% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 82.04% | 98.21% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.16% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alnus alnobetula subsp. fruticosa |
| Brassica napus |
| PubChem | 24148525 |
| LOTUS | LTS0177882 |
| wikiData | Q105300616 |