3-Methoxy-5-[1-methoxy-2-(4-methoxy-3-methylphenyl)ethyl]benzene-1,2-diol
| Internal ID | d4f5578f-7d9f-46de-bb83-237a0f69830b |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 3-methoxy-5-[1-methoxy-2-(4-methoxy-3-methylphenyl)ethyl]benzene-1,2-diol |
| SMILES (Canonical) | CC1=C(C=CC(=C1)CC(C2=CC(=C(C(=C2)OC)O)O)OC)OC |
| SMILES (Isomeric) | CC1=C(C=CC(=C1)CC(C2=CC(=C(C(=C2)OC)O)O)OC)OC |
| InChI | InChI=1S/C18H22O5/c1-11-7-12(5-6-15(11)21-2)8-16(22-3)13-9-14(19)18(20)17(10-13)23-4/h5-7,9-10,16,19-20H,8H2,1-4H3 |
| InChI Key | AAMXENBJSGGNRE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of 3-Methoxy-5-[1-methoxy-2-(4-methoxy-3-methylphenyl)ethyl]benzene-1,2-diol](https://plantaedb.com/storage/docs/compounds/2023/11/3-methoxy-5-1-methoxy-2-4-methoxy-3-methylphenylethylbenzene-12-diol.jpg "2D Structure of 3-Methoxy-5-[1-methoxy-2-(4-methoxy-3-methylphenyl)ethyl]benzene-1,2-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.47% | 90.20% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.58% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.87% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.45% | 96.09% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 91.01% | 90.24% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.13% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.15% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.09% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.62% | 99.15% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.37% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.92% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.96% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.86% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.02% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.67% | 95.50% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.65% | 92.68% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.14% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.47% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.17% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.59% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium moniliforme |
| PubChem | 162866683 |
| LOTUS | LTS0260524 |
| wikiData | Q104908041 |