3-methoxy-4b,8,8-trimethyl-2-propan-2-yl-6,7-dihydro-5H-fluorene-1,4-dione
| Internal ID | e7ad8b8b-7757-46a7-a037-296c19851b8c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 3-methoxy-4b,8,8-trimethyl-2-propan-2-yl-6,7-dihydro-5H-fluorene-1,4-dione |
| SMILES (Canonical) | CC(C)C1=C(C(=O)C2=C(C1=O)C=C3C2(CCCC3(C)C)C)OC |
| SMILES (Isomeric) | CC(C)C1=C(C(=O)C2=C(C1=O)C=C3C2(CCCC3(C)C)C)OC |
| InChI | InChI=1S/C20H26O3/c1-11(2)14-16(21)12-10-13-19(3,4)8-7-9-20(13,5)15(12)17(22)18(14)23-6/h10-11H,7-9H2,1-6H3 |
| InChI Key | LEXZEULYIQDNCX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18819469 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.81% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.77% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.27% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.88% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.39% | 94.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.41% | 93.99% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.03% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.34% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.27% | 82.69% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.37% | 94.45% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.55% | 97.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.01% | 95.89% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.79% | 85.30% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.51% | 99.23% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.24% | 91.07% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.97% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Taiwania cryptomerioides |
| PubChem | 11645341 |
| LOTUS | LTS0226105 |
| wikiData | Q105150883 |