3-Methoxy-3',4'-methylenedioxy-cis-stilbene
| Internal ID | 2cc48a73-8192-4da6-87bd-c06cca1611dd |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 5-[(Z)-2-(3-methoxyphenyl)ethenyl]-1,3-benzodioxole |
| SMILES (Canonical) | COC1=CC=CC(=C1)C=CC2=CC3=C(C=C2)OCO3 |
| SMILES (Isomeric) | COC1=CC=CC(=C1)/C=C\C2=CC3=C(C=C2)OCO3 |
| InChI | InChI=1S/C16H14O3/c1-17-14-4-2-3-12(9-14)5-6-13-7-8-15-16(10-13)19-11-18-15/h2-10H,11H2,1H3/b6-5- |
| InChI Key | YPXYXYXQAADVML-WAYWQWQTSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 27.70 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 97.87% | 89.76% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.76% | 91.11% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.07% | 96.77% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 96.54% | 94.80% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.36% | 96.00% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 95.66% | 92.51% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.61% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.28% | 95.56% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 93.47% | 85.30% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.78% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.63% | 94.73% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.58% | 93.99% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 88.14% | 80.96% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.20% | 92.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.80% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.16% | 96.09% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 85.06% | 81.29% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.67% | 100.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.38% | 99.18% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.80% | 98.75% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.98% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.98% | 90.00% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 80.92% | 93.24% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.81% | 95.89% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.13% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 129861914 |
| LOTUS | LTS0107014 |
| wikiData | Q105352061 |