3-Methoxy-2,4-bis(3-methylbut-2-enyl)-5-(2-phenylethenyl)phenol
Internal ID | 10eb8a12-2867-4ba3-8f31-17182a1f4b9f |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 3-methoxy-2,4-bis(3-methylbut-2-enyl)-5-(2-phenylethenyl)phenol |
SMILES (Canonical) | CC(=CCC1=C(C(=C(C=C1C=CC2=CC=CC=C2)O)CC=C(C)C)OC)C |
SMILES (Isomeric) | CC(=CCC1=C(C(=C(C=C1C=CC2=CC=CC=C2)O)CC=C(C)C)OC)C |
InChI | InChI=1S/C25H30O2/c1-18(2)11-15-22-21(14-13-20-9-7-6-8-10-20)17-24(26)23(25(22)27-5)16-12-19(3)4/h6-14,17,26H,15-16H2,1-5H3 |
InChI Key | ZMMOCDBCJOUFDQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H30O2 |
Molecular Weight | 362.50 g/mol |
Exact Mass | 362.224580195 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 7.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.20% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.03% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.93% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.37% | 93.99% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.69% | 94.62% |
CHEMBL2581 | P07339 | Cathepsin D | 90.08% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.22% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.90% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.26% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.61% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.69% | 94.45% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.88% | 94.08% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.55% | 90.17% |
CHEMBL3194 | P02766 | Transthyretin | 80.55% | 90.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.45% | 95.50% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.21% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lonchocarpus chiricanus |
PubChem | 85305458 |
LOTUS | LTS0167502 |
wikiData | Q105379524 |