3-Isopropyl-2-methoxypyrido[2,3-b]pyrazine
| Internal ID | 4ee20f53-4dfe-4a09-aed2-75c8df18a5fd |
| Taxonomy | Organoheterocyclic compounds > Pyridopyrazines |
| IUPAC Name | 2-methoxy-3-propan-2-ylpyrido[2,3-b]pyrazine |
| SMILES (Canonical) | CC(C)C1=NC2=C(C=CC=N2)N=C1OC |
| SMILES (Isomeric) | CC(C)C1=NC2=C(C=CC=N2)N=C1OC |
| InChI | InChI=1S/C11H13N3O/c1-7(2)9-11(15-3)13-8-5-4-6-12-10(8)14-9/h4-7H,1-3H3 |
| InChI Key | SRMZEDJVEFZIQU-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.105862047 g/mol |
| Topological Polar Surface Area (TPSA) | 47.90 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.91% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.38% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.60% | 96.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 89.28% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.50% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.15% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.69% | 98.95% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.99% | 93.10% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.70% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.90% | 98.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.91% | 99.15% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 82.56% | 92.97% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.41% | 94.03% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.78% | 85.14% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.50% | 94.75% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.08% | 96.67% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.07% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 91664815 |
| LOTUS | LTS0109494 |
| wikiData | Q105259303 |