3-Iodo-L-Tyrosine
| Internal ID | 3d157c14-d2a3-4193-8dd3-bb801d305ceb |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Tyrosine and derivatives |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C9H10INO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m0/s1 |
| InChI Key | UQTZMGFTRHFAAM-ZETCQYMHSA-N |
| Popularity | 775 references in papers |
| Molecular Formula | C9H10INO3 |
| Molecular Weight | 307.08 g/mol |
| Exact Mass | 306.97054 g/mol |
| Topological Polar Surface Area (TPSA) | 83.60 Ų |
| XlogP | -1.10 |
| 70-78-0 |
| H-Tyr(3-I)-OH |
| 3-IODOTYROSINE |
| L-Tyrosine, 3-iodo- |
| Monoiodotyrosine |
| (S)-2-Amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| 3-IODO-TYROSINE |
| IODOTYROSINE |
| 3-Monoiodo-L-tyrosine |
| (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293237 | P54132 | Bloom syndrome protein |
2.8 nM |
Potency |
via Super-PRED
|
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
501.2 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.24% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.76% | 99.15% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.73% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.12% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.83% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.65% | 99.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.10% | 96.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.15% | 90.24% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 86.77% | 92.29% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.68% | 90.20% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.67% | 97.21% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.28% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.21% | 95.56% |
| CHEMBL236 | P41143 | Delta opioid receptor | 82.85% | 99.35% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.71% | 83.82% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.58% | 91.49% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.56% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 439744 |
| LOTUS | LTS0133688 |
| wikiData | Q410703 |