3-Hydroxypentadecanoic acid
| Internal ID | 8b9f42d2-ef36-4245-a6d4-e7d527e1a87a |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | 3-hydroxypentadecanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-14(16)13-15(17)18/h14,16H,2-13H2,1H3,(H,17,18) |
| InChI Key | ATMSEJBABXCWDW-UHFFFAOYSA-N |
| Popularity | 16 references in papers |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.21949481 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 5.20 |
| 32602-70-3 |
| 3-hydroxy-pentadecanoic acid |
| Pentadecanoic acid, 3-hydroxy- |
| rac-3-Hydroxypentadecanoic Acid |
| (+/-)-3-hydroxypentadecanoic acid |
| SCHEMBL311217 |
| DTXSID70954329 |
| CHEBI:176993 |
| LMFA01050183 |
| MFCD00210306 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3714079 | Q9NQS5 | G-protein coupled receptor 84 |
432 nM 110 nM 452 nM |
EC50 Ki EC50 |
via Super-PRED
via Super-PRED via Super-PRED |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.37% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.07% | 96.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.05% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.40% | 99.17% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.94% | 92.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.25% | 93.56% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.37% | 92.86% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.49% | 90.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.81% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.75% | 100.00% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 83.55% | 85.94% |
| CHEMBL3776 | Q14790 | Caspase-8 | 81.21% | 97.06% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.63% | 96.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.05% | 91.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 182089 |
| LOTUS | LTS0072634 |
| wikiData | Q82933474 |