3-Hydroxychavicol 1-glucoside
Internal ID | 5677a48a-35c1-4261-8a6d-053ac6af23e9 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 2-(hydroxymethyl)-6-(2-hydroxy-4-prop-2-enylphenoxy)oxane-3,4,5-triol |
SMILES (Canonical) | C=CCC1=CC(=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O)O |
SMILES (Isomeric) | C=CCC1=CC(=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O)O |
InChI | InChI=1S/C15H20O7/c1-2-3-8-4-5-10(9(17)6-8)21-15-14(20)13(19)12(18)11(7-16)22-15/h2,4-6,11-20H,1,3,7H2 |
InChI Key | SUXVWSIPTXXPOZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H20O7 |
Molecular Weight | 312.31 g/mol |
Exact Mass | 312.12090297 g/mol |
Topological Polar Surface Area (TPSA) | 120.00 Ų |
XlogP | 0.20 |
CHEBI:168428 |
2-(hydroxymethyl)-6-(2-hydroxy-4-prop-2-enylphenoxy)oxane-3,4,5-triol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.51% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.37% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.07% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.16% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.32% | 94.45% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.65% | 83.57% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.10% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 88.07% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 86.46% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.43% | 94.73% |
CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 84.21% | 97.88% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.05% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.95% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.42% | 86.92% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.13% | 96.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.39% | 96.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.33% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia officinarum |
Mentha spicata subsp. spicata |
Monarda punctata |
Ocimum tenuiflorum |
PubChem | 78384828 |
LOTUS | LTS0221173 |
wikiData | Q105261649 |