3-hydroxy-N-(2-oxooxolan-3-yl)decanamide
| Internal ID | b4aad576-84e0-43e7-be56-74a997af3611 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids and derivatives |
| IUPAC Name | 3-hydroxy-N-(2-oxooxolan-3-yl)decanamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H25NO4/c1-2-3-4-5-6-7-11(16)10-13(17)15-12-8-9-19-14(12)18/h11-12,16H,2-10H2,1H3,(H,15,17) |
| InChI Key | DOICJCCMIBBSOO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.17835828 g/mol |
| Topological Polar Surface Area (TPSA) | 75.60 Ų |
| XlogP | 2.90 |
| N-(3-Hydroxydecanoyl)-DL-homoserine lactone |
| 3-hydroxy-N-(2-oxooxolan-3-yl)decanamide |
| CHEBI:182731 |
| AKOS040755560 |
| N-3-hydroxydecanoyl-DL-Homoserine lactone |
| PD048775 |
| 3-Hydroxy-N-(tetrahydro-2-oxo-3-furanyl)-decanamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.98% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.04% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.82% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.17% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.67% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.67% | 94.45% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.58% | 97.29% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 86.89% | 94.66% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.42% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.11% | 97.09% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.98% | 92.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.81% | 96.47% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.91% | 93.56% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.83% | 92.88% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 84.78% | 89.63% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.57% | 90.08% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 82.07% | 96.33% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 81.92% | 96.11% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 81.56% | 96.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.47% | 90.71% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.42% | 94.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.79% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.79% | 95.50% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.61% | 92.08% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.45% | 98.03% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.29% | 94.80% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.14% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11521893 |
| LOTUS | LTS0075880 |
| wikiData | Q104985999 |