3-Hydroxy-9,10-dioxo-anthracene-2-carbaldehyde
| Internal ID | 81d6c562-5b41-4561-9074-2dc07ea74bee |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | 3-hydroxy-9,10-dioxoanthracene-2-carbaldehyde |
| SMILES (Canonical) | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C(=C3)C=O)O |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C(=C3)C=O)O |
| InChI | InChI=1S/C15H8O4/c16-7-8-5-11-12(6-13(8)17)15(19)10-4-2-1-3-9(10)14(11)18/h1-7,17H |
| InChI Key | OIQHIFSGCMLQQJ-UHFFFAOYSA-N |
| Popularity | 9 references in papers |
| Molecular Formula | C15H8O4 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.04225873 g/mol |
| Topological Polar Surface Area (TPSA) | 71.40 Ų |
| XlogP | 2.50 |
| 3-hydroxyanthraquinone-2-carbaldehyde |
| 2-Formyl-3-hydroxy-9,10-anthroquinone |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.35% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.25% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.81% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.16% | 91.11% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 95.55% | 98.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.66% | 93.40% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.45% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.27% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.11% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.94% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.77% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.77% | 94.73% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.98% | 82.69% |
| CHEMBL3194 | P02766 | Transthyretin | 80.67% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Morinda lucida |
| Rennellia elliptica |
| PubChem | 10198899 |
| LOTUS | LTS0240046 |
| wikiData | Q105192670 |