3-Hydroxy-5,8-dimethoxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one
Internal ID | 00a96718-bad9-4d60-ae6e-4fe68d46fa75 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 3-hydroxy-5,8-dimethoxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
SMILES (Canonical) | COC1=C2C(=C(C=C1)OC)OC3=C(C2=O)C(=CC(=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C2C(=C(C=C1)OC)OC3=C(C2=O)C(=CC(=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C21H22O11/c1-28-9-3-4-10(29-2)20-15(9)17(25)14-11(30-20)5-8(23)6-12(14)31-21-19(27)18(26)16(24)13(7-22)32-21/h3-6,13,16,18-19,21-24,26-27H,7H2,1-2H3 |
InChI Key | DUANMTAIMXQVFX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O11 |
Molecular Weight | 450.40 g/mol |
Exact Mass | 450.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 164.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.52% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.28% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.36% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.34% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.18% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.54% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.07% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.52% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 86.85% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.16% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.69% | 94.45% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.20% | 96.21% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.97% | 83.82% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.85% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 81.51% | 98.75% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.92% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.05% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Swertia petiolata |
PubChem | 163018586 |
LOTUS | LTS0171621 |
wikiData | Q104989125 |