3'-Hydroxy-4,7-bis(4-hydroxyphenyl)-2'-methylspiro[1,3-benzodioxole-2,6'-2,3-dihydropyran]-5,6-dione
| Internal ID | 1634fecf-928d-4bc1-af5f-5b9271d47beb |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ortho esters |
| IUPAC Name | 3'-hydroxy-4,7-bis(4-hydroxyphenyl)-2'-methylspiro[1,3-benzodioxole-2,6'-2,3-dihydropyran]-5,6-dione |
| SMILES (Canonical) | CC1C(C=CC2(O1)OC3=C(C(=O)C(=O)C(=C3O2)C4=CC=C(C=C4)O)C5=CC=C(C=C5)O)O |
| SMILES (Isomeric) | CC1C(C=CC2(O1)OC3=C(C(=O)C(=O)C(=C3O2)C4=CC=C(C=C4)O)C5=CC=C(C=C5)O)O |
| InChI | InChI=1S/C24H18O8/c1-12-17(27)10-11-24(30-12)31-22-18(13-2-6-15(25)7-3-13)20(28)21(29)19(23(22)32-24)14-4-8-16(26)9-5-14/h2-12,17,25-27H,1H3 |
| InChI Key | RJOYVERLYHMZBT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H18O8 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.10016753 g/mol |
| Topological Polar Surface Area (TPSA) | 123.00 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
![2D Structure of 3'-Hydroxy-4,7-bis(4-hydroxyphenyl)-2'-methylspiro[1,3-benzodioxole-2,6'-2,3-dihydropyran]-5,6-dione](https://plantaedb.com/storage/docs/compounds/2023/11/3-hydroxy-47-bis4-hydroxyphenyl-2-methylspiro13-benzodioxole-26-23-dihydropyran-56-dione.jpg "2D Structure of 3'-Hydroxy-4,7-bis(4-hydroxyphenyl)-2'-methylspiro[1,3-benzodioxole-2,6'-2,3-dihydropyran]-5,6-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.36% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.20% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.17% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.56% | 91.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.20% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.99% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.61% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.09% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.06% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.35% | 94.73% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 86.44% | 98.35% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.93% | 91.71% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 84.09% | 89.63% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.93% | 93.10% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.80% | 94.00% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.56% | 91.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14426700 |
| LOTUS | LTS0078847 |
| wikiData | Q105237646 |