3-Hydroxy-4-methylindeno[1,2-b]pyridin-5-one
| Internal ID | f3751847-f8fe-4557-bde6-f6c8129a4ce1 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aryl ketones |
| IUPAC Name | 3-hydroxy-4-methylindeno[1,2-b]pyridin-5-one |
| SMILES (Canonical) | CC1=C2C(=NC=C1O)C3=CC=CC=C3C2=O |
| SMILES (Isomeric) | CC1=C2C(=NC=C1O)C3=CC=CC=C3C2=O |
| InChI | InChI=1S/C13H9NO2/c1-7-10(15)6-14-12-8-4-2-3-5-9(8)13(16)11(7)12/h2-6,15H,1H3 |
| InChI Key | NXDKVXVMXMSWAG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.063328530 g/mol |
| Topological Polar Surface Area (TPSA) | 50.20 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
![2D Structure of 3-Hydroxy-4-methylindeno[1,2-b]pyridin-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/3-hydroxy-4-methylindeno12-bpyridin-5-one.jpg "2D Structure of 3-Hydroxy-4-methylindeno[1,2-b]pyridin-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.83% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.57% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.56% | 95.56% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 90.17% | 93.65% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 89.85% | 96.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.41% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.91% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.90% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.72% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.27% | 98.75% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 85.93% | 91.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.96% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.46% | 94.75% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 82.17% | 91.73% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.03% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Trivalvaria costata |
| PubChem | 102080682 |
| LOTUS | LTS0169118 |
| wikiData | Q105187109 |