3-Hydroxy-4-isopropylbenzoic acid
Internal ID | 5e7badf6-0842-4142-a84d-9837d8c74db6 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Aromatic monoterpenoids |
IUPAC Name | 3-hydroxy-4-propan-2-ylbenzoic acid |
SMILES (Canonical) | CC(C)C1=C(C=C(C=C1)C(=O)O)O |
SMILES (Isomeric) | CC(C)C1=C(C=C(C=C1)C(=O)O)O |
InChI | InChI=1S/C10H12O3/c1-6(2)8-4-3-7(10(12)13)5-9(8)11/h3-6,11H,1-2H3,(H,12,13) |
InChI Key | GBNCQQKBWZJIGX-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C10H12O3 |
Molecular Weight | 180.20 g/mol |
Exact Mass | 180.078644241 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 2.20 |
19420-59-8 |
3-hydroxy-4-(propan-2-yl)benzoic acid |
Benzoic acid, 3-hydroxy-4-isopropyl- |
SCHEMBL5366250 |
3-Hydroxy-4-isopropylbenzoicacid |
DTXSID10941137 |
MB22489 |
CS-0449503 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 92.51% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 90.88% | 90.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.26% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.20% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.05% | 91.11% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 86.41% | 89.23% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.24% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.21% | 86.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.98% | 93.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.73% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.43% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.39% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Libocedrus yateensis |
PubChem | 177068 |
LOTUS | LTS0090721 |
wikiData | Q82917921 |