3-Hydroxy-3-(thiazol-2-yl)indolin-2-one
| Internal ID | a1885665-001b-4de8-a987-e858302f9d64 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolines |
| IUPAC Name | 3-hydroxy-3-(1,3-thiazol-2-yl)-1H-indol-2-one |
| SMILES (Canonical) | C1=CC=C2C(=C1)C(C(=O)N2)(C3=NC=CS3)O |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C(C(=O)N2)(C3=NC=CS3)O |
| InChI | InChI=1S/C11H8N2O2S/c14-9-11(15,10-12-5-6-16-10)7-3-1-2-4-8(7)13-9/h1-6,15H,(H,13,14) |
| InChI Key | BURKMBCVRAOKIE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03064868 g/mol |
| Topological Polar Surface Area (TPSA) | 90.50 Ų |
| XlogP | 0.80 |
| 3-hydroxy-3-(1,3-thiazol-2-yl)-2,3-dihydro-1H-indol-2-one |
| 3-hydroxy-3-(1,3-thiazol-2-yl)-1H-indol-2-one |
| SCHEMBL24281866 |
| CHEBI:65024 |
| Q27133587 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 95.97% | 94.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.92% | 91.11% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 93.17% | 92.97% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.60% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.31% | 90.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.77% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.50% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.28% | 95.50% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.56% | 94.08% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.03% | 85.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.88% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.63% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.59% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.81% | 85.14% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 81.60% | 96.47% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.38% | 93.03% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.17% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 5297666 |
| LOTUS | LTS0250056 |
| wikiData | Q27133587 |