3-Hydroxy-2,4-dimethoxy-7,8-methylenedioxyphenanthrene
| Internal ID | f8237dcb-e3ea-47ec-8f10-a340142d8e07 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 7,9-dimethoxynaphtho[1,2-g][1,3]benzodioxol-8-ol |
| SMILES (Canonical) | COC1=C(C(=C2C(=C1)C=CC3=C2C=CC4=C3OCO4)OC)O |
| SMILES (Isomeric) | COC1=C(C(=C2C(=C1)C=CC3=C2C=CC4=C3OCO4)OC)O |
| InChI | InChI=1S/C17H14O5/c1-19-13-7-9-3-4-11-10(14(9)17(20-2)15(13)18)5-6-12-16(11)22-8-21-12/h3-7,18H,8H2,1-2H3 |
| InChI Key | RDOYGGIEUXRWEI-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 57.20 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.07% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.75% | 94.45% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.29% | 96.77% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.15% | 92.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.51% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.89% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.21% | 89.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.11% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.78% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.70% | 89.00% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.12% | 82.67% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.71% | 96.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.04% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.66% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.28% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.00% | 95.50% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.87% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dioscorea communis |
| PubChem | 91069813 |
| LOTUS | LTS0132811 |
| wikiData | Q105234362 |