3-hydroxy-2,11,12-trimethoxy-2,3,5,6-tetrahydro-1H-indolo[7a,1-a]isoquinoline-8,9-dione
| Internal ID | 765cb291-501b-40db-b9bc-b50c79ae6d70 |
| Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Erythrinanes |
| IUPAC Name | 3-hydroxy-2,11,12-trimethoxy-2,3,5,6-tetrahydro-1H-indolo[7a,1-a]isoquinoline-8,9-dione |
| SMILES (Canonical) | COC1CC23C(=CC1O)CCN2C(=O)C(=O)C4=CC(=C(C=C34)OC)OC |
| SMILES (Isomeric) | COC1CC23C(=CC1O)CCN2C(=O)C(=O)C4=CC(=C(C=C34)OC)OC |
| InChI | InChI=1S/C19H21NO6/c1-24-14-7-11-12(8-15(14)25-2)19-9-16(26-3)13(21)6-10(19)4-5-20(19)18(23)17(11)22/h6-8,13,16,21H,4-5,9H2,1-3H3 |
| InChI Key | ZLVUKTCVZMRXFB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.13688739 g/mol |
| Topological Polar Surface Area (TPSA) | 85.30 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
![2D Structure of 3-hydroxy-2,11,12-trimethoxy-2,3,5,6-tetrahydro-1H-indolo[7a,1-a]isoquinoline-8,9-dione](https://plantaedb.com/storage/docs/compounds/2023/11/3-hydroxy-21112-trimethoxy-2356-tetrahydro-1h-indolo7a1-aisoquinoline-89-dione.jpg "2D Structure of 3-hydroxy-2,11,12-trimethoxy-2,3,5,6-tetrahydro-1H-indolo[7a,1-a]isoquinoline-8,9-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.35% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.50% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 96.09% | 92.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.52% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.74% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.47% | 93.40% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.31% | 96.38% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 86.79% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.07% | 94.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.73% | 91.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.56% | 97.14% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.73% | 93.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.69% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.36% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.32% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.20% | 90.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.77% | 96.77% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 82.61% | 92.38% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.48% | 90.24% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.06% | 89.00% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.78% | 95.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina subumbrans |
| PubChem | 162974908 |
| LOTUS | LTS0005059 |
| wikiData | Q105379235 |