[3-Hydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-phenylprop-2-enoate
| Internal ID | 1a7953b0-0f98-4d98-adfd-22548b07dc02 |
| Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols |
| IUPAC Name | [3-hydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-phenylprop-2-enoate |
| SMILES (Canonical) | C1=CC=C(C=C1)C=CC(=O)OCC(CO)OC2C(C(C(C(O2)CO)O)O)O |
| SMILES (Isomeric) | C1=CC=C(C=C1)C=CC(=O)OCC(CO)OC2C(C(C(C(O2)CO)O)O)O |
| InChI | InChI=1S/C18H24O9/c19-8-12(10-25-14(21)7-6-11-4-2-1-3-5-11)26-18-17(24)16(23)15(22)13(9-20)27-18/h1-7,12-13,15-20,22-24H,8-10H2 |
| InChI Key | OIHPPMVRCNQMAV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H24O9 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14203234 g/mol |
| Topological Polar Surface Area (TPSA) | 146.00 Ų |
| XlogP | -0.70 |
| There are no found synonyms. |
![2D Structure of [3-Hydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-phenylprop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/3-hydroxy-2-345-trihydroxy-6-hydroxymethyloxan-2-yloxypropyl-3-phenylprop-2-enoate.jpg "2D Structure of [3-Hydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-phenylprop-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.32% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.25% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.23% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.21% | 96.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.66% | 94.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.74% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.25% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.89% | 94.73% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.51% | 94.23% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 88.27% | 89.67% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.59% | 90.17% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.97% | 94.08% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.06% | 83.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.40% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.02% | 97.09% |
| CHEMBL5028 | O14672 | ADAM10 | 81.69% | 97.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.15% | 98.95% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.78% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lilium mackliniae |
| PubChem | 162909020 |
| LOTUS | LTS0123348 |
| wikiData | Q105192513 |