3-Hydroxy-14-methyl-1,4-diazapentacyclo[7.7.1.02,12.03,8.011,16]heptadecan-5-one
| Internal ID | f0becd0c-7c1c-4509-be08-2c6e48b6799a |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Naphthyridines |
| IUPAC Name | 3-hydroxy-14-methyl-1,4-diazapentacyclo[7.7.1.02,12.03,8.011,16]heptadecan-5-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H24N2O2/c1-8-4-11-10-6-9-7-18(13(10)5-8)15(11)16(20)12(9)2-3-14(19)17-16/h8-13,15,20H,2-7H2,1H3,(H,17,19) |
| InChI Key | NVAVRHCNQUQCGY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.183778013 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.97% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.69% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.93% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.71% | 97.09% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 89.20% | 97.05% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.12% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.81% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.60% | 98.95% |
| CHEMBL1871 | P10275 | Androgen Receptor | 87.25% | 96.43% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.70% | 100.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.24% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.41% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.39% | 94.75% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.42% | 94.78% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.26% | 85.11% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.00% | 92.97% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163016683 |
| LOTUS | LTS0203878 |
| wikiData | Q105186129 |