3-Hydroxy-1,2,7-trimethoxyxanthen-9-one
| Internal ID | 993ef6ac-a734-4df9-9315-07f1cd0b61cb |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 3-hydroxy-1,2,7-trimethoxyxanthen-9-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1)OC3=C(C2=O)C(=C(C(=C3)O)OC)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)OC3=C(C2=O)C(=C(C(=C3)O)OC)OC |
| InChI | InChI=1S/C16H14O6/c1-19-8-4-5-11-9(6-8)14(18)13-12(22-11)7-10(17)15(20-2)16(13)21-3/h4-7,17H,1-3H3 |
| InChI Key | OFDFRKMEYPDRSD-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 74.20 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.95% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.57% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.32% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.96% | 93.99% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.04% | 99.15% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.78% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.62% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.16% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.89% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.65% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.60% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.15% | 90.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.93% | 93.65% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.50% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Polygala japonica |
| Polygala tenuifolia |
| PubChem | 85670528 |
| LOTUS | LTS0052038 |
| wikiData | Q105190840 |