[3-Hydroxy-1-(4-methoxy-1-methyl-2-oxoquinolin-3-yl)butan-2-yl] acetate
| Internal ID | 3c0c2520-5b56-4879-9dbd-464129778457 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | [3-hydroxy-1-(4-methoxy-1-methyl-2-oxoquinolin-3-yl)butan-2-yl] acetate |
| SMILES (Canonical) | CC(C(CC1=C(C2=CC=CC=C2N(C1=O)C)OC)OC(=O)C)O |
| SMILES (Isomeric) | CC(C(CC1=C(C2=CC=CC=C2N(C1=O)C)OC)OC(=O)C)O |
| InChI | InChI=1S/C17H21NO5/c1-10(19)15(23-11(2)20)9-13-16(22-4)12-7-5-6-8-14(12)18(3)17(13)21/h5-8,10,15,19H,9H2,1-4H3 |
| InChI Key | BFLBNGMXMRCXAG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.14197277 g/mol |
| Topological Polar Surface Area (TPSA) | 76.10 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
![2D Structure of [3-Hydroxy-1-(4-methoxy-1-methyl-2-oxoquinolin-3-yl)butan-2-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/3-hydroxy-1-4-methoxy-1-methyl-2-oxoquinolin-3-ylbutan-2-yl-acetate.jpg "2D Structure of [3-Hydroxy-1-(4-methoxy-1-methyl-2-oxoquinolin-3-yl)butan-2-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.38% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.21% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.47% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.75% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.65% | 83.82% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 92.65% | 98.59% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.18% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.17% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.74% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.08% | 94.00% |
| CHEMBL240 | Q12809 | HERG | 83.32% | 89.76% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.82% | 93.99% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.07% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.04% | 98.75% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.01% | 87.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Skimmia laureola |
| PubChem | 162888256 |
| LOTUS | LTS0178135 |
| wikiData | Q104934368 |