3-Furoic acid
| Internal ID | 8d9c0c2e-996d-48fc-aae7-9ee315e228e8 |
| Taxonomy | Organoheterocyclic compounds > Furans > Furoic acid and derivatives > Furoic acids |
| IUPAC Name | furan-3-carboxylic acid |
| SMILES (Canonical) | C1=COC=C1C(=O)O |
| SMILES (Isomeric) | C1=COC=C1C(=O)O |
| InChI | InChI=1S/C5H4O3/c6-5(7)4-1-2-8-3-4/h1-3H,(H,6,7) |
| InChI Key | IHCCAYCGZOLTEU-UHFFFAOYSA-N |
| Popularity | 80 references in papers |
| Molecular Formula | C5H4O3 |
| Molecular Weight | 112.08 g/mol |
| Exact Mass | 112.016043985 g/mol |
| Topological Polar Surface Area (TPSA) | 50.40 Ų |
| XlogP | 1.00 |
| furan-3-carboxylic acid |
| 488-93-7 |
| 3-Furancarboxylic acid |
| 3-carboxyfuran |
| 3-Furanoic acid |
| MFCD00005350 |
| 88A3S7RG98 |
| NSC-349941 |
| UNII-88A3S7RG98 |
| 3-Furanoate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 94.83% | 87.67% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 88.48% | 81.11% |
| CHEMBL3194 | P02766 | Transthyretin | 83.88% | 90.71% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 83.03% | 95.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.64% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.11% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Brachystemma calycinum |
| Euonymus europaeus |
| Peristeria elata |
| Phaseolus vulgaris |
| Tripterygium wilfordii |
| PubChem | 10268 |
| LOTUS | LTS0105731 |
| wikiData | Q21045227 |