(3-Formyl-4-hydroxy-4a,8,8-trimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl) 3-phenylprop-2-enoate
| Internal ID | c2de4950-f3c3-41bc-a733-eafacfead6dd |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
| IUPAC Name | (3-formyl-4-hydroxy-4a,8,8-trimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl) 3-phenylprop-2-enoate |
| SMILES (Canonical) | CC1(CCCC2(C1C(C=C(C2O)C=O)OC(=O)C=CC3=CC=CC=C3)C)C |
| SMILES (Isomeric) | CC1(CCCC2(C1C(C=C(C2O)C=O)OC(=O)C=CC3=CC=CC=C3)C)C |
| InChI | InChI=1S/C23H28O4/c1-22(2)12-7-13-23(3)20(22)18(14-17(15-24)21(23)26)27-19(25)11-10-16-8-5-4-6-9-16/h4-6,8-11,14-15,18,20-21,26H,7,12-13H2,1-3H3 |
| InChI Key | MBSDPPCRLFNZBS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19875937 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.37% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.91% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.40% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.25% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.19% | 90.17% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 94.60% | 94.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.21% | 96.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.08% | 94.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.45% | 95.50% |
| CHEMBL5028 | O14672 | ADAM10 | 88.75% | 97.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.03% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.78% | 96.00% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.65% | 83.00% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.02% | 94.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.28% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162814073 |
| LOTUS | LTS0132513 |
| wikiData | Q104171544 |