3-Ethoxy-5-hydroxy-7-methoxyphenanthrene-1,4-dione
| Internal ID | 5a4b1ac8-3ed5-4cb1-8cdb-fe3c917d8738 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 3-ethoxy-5-hydroxy-7-methoxyphenanthrene-1,4-dione |
| SMILES (Canonical) | CCOC1=CC(=O)C2=C(C1=O)C3=C(C=C(C=C3C=C2)OC)O |
| SMILES (Isomeric) | CCOC1=CC(=O)C2=C(C1=O)C3=C(C=C(C=C3C=C2)OC)O |
| InChI | InChI=1S/C17H14O5/c1-3-22-14-8-12(18)11-5-4-9-6-10(21-2)7-13(19)15(9)16(11)17(14)20/h4-8,19H,3H2,1-2H3 |
| InChI Key | RNXYLFAKSJROKT-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.38% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.88% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.40% | 91.49% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 93.30% | 92.68% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.11% | 95.56% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 91.59% | 96.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.19% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.40% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.16% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.96% | 93.99% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.88% | 96.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.83% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.11% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.53% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.64% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.95% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.70% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.53% | 94.75% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.37% | 96.12% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.01% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium xantholeucum |
| Ligularia duciformis |
| PubChem | 21668767 |
| LOTUS | LTS0067938 |
| wikiData | Q105210269 |