3-Ethenyl-6-methoxybenzene-1,2-diol
| Internal ID | d7327995-62fb-45cf-a5a3-ba77e6fef91e |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 3-ethenyl-6-methoxybenzene-1,2-diol |
| SMILES (Canonical) | COC1=C(C(=C(C=C1)C=C)O)O |
| SMILES (Isomeric) | COC1=C(C(=C(C=C1)C=C)O)O |
| InChI | InChI=1S/C9H10O3/c1-3-6-4-5-7(12-2)9(11)8(6)10/h3-5,10-11H,1H2,2H3 |
| InChI Key | KRPXWQJAYIUHCI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.30% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.70% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.67% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.22% | 90.20% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.44% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.29% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.76% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.78% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.41% | 98.95% |
| CHEMBL3194 | P02766 | Transthyretin | 83.09% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.52% | 90.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 81.16% | 98.11% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.99% | 97.36% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.50% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zingiber officinale |
| PubChem | 163102488 |
| LOTUS | LTS0201370 |
| wikiData | Q105145161 |