3-[(E)-2-[(1R,4aS,8aR)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]ethenyl]furan
Internal ID | 14960324-3b8e-40ae-b6e3-694cd105bfb2 |
Taxonomy | Organoheterocyclic compounds > Heteroaromatic compounds |
IUPAC Name | 3-[(E)-2-[(1R,4aS,8aR)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]ethenyl]furan |
SMILES (Canonical) | CC1(CCCC2(C1CCCC2C=CC3=COC=C3)C)C |
SMILES (Isomeric) | C[C@]12CCCC([C@@H]1CCC[C@@H]2/C=C/C3=COC=C3)(C)C |
InChI | InChI=1S/C19H28O/c1-18(2)11-5-12-19(3)16(6-4-7-17(18)19)9-8-15-10-13-20-14-15/h8-10,13-14,16-17H,4-7,11-12H2,1-3H3/b9-8+/t16-,17+,19-/m1/s1 |
InChI Key | STILUCCUBLROHD-HPRQGZMESA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H28O |
Molecular Weight | 272.40 g/mol |
Exact Mass | 272.214015512 g/mol |
Topological Polar Surface Area (TPSA) | 13.10 Ų |
XlogP | 6.60 |
There are no found synonyms. |
![2D Structure of 3-[(E)-2-[(1R,4aS,8aR)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]ethenyl]furan 2D Structure of 3-[(E)-2-[(1R,4aS,8aR)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]ethenyl]furan](https://plantaedb.com/storage/docs/compounds/2023/11/3-e-2-1r4as8ar-558a-trimethyl-12344a678-octahydronaphthalen-1-ylethenylfuran.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.07% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.57% | 97.09% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 90.94% | 92.51% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.61% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.35% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.61% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.84% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.23% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.14% | 89.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.45% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.17% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hedychium villosum |
PubChem | 163189384 |
LOTUS | LTS0129261 |
wikiData | Q105260268 |